irofulven


irofulven; (5'R)-5'-hydroxy-1'-(hydroxymethyl)-2',5',7'-trimethylspiro[cyclopropane-1,6'-indene]-4'-one; (6'R)-6'-hydroxy-3'-(hydroxymethyl)-2',4',6'-trimethylspiro[cyclopropane-1,5'-inden]-7'(6'H)-one
Links:📖 PubMed
MeSH:Alkylating Agents; Antineoplastic Agents; Noxae; Radiation-Sensitizing Agents; Antineoplastic Agents; Noxae; Radiation-Sensitizing Agents
CAS:[158440-71-2]
Formula:C15H18O3; 246.31 g/mol
InChiKey:NICJCIQSJJKZAH-AWEZNQCLSA-N
SMILES:CC1=C(CO)C2=C(C)C3(CC3)[C@@](C)(O)C(=O)C2=C1
Molecular structure of irofulven
Density:1.285 g/mL
Molar volume:191.7 mL/mol

Isomers

ambrosin
Molecular structure of ambrosin
irofulven
Molecular structure of irofulven
loxoprofen
Molecular structure of loxoprofen
santonin
Molecular structure of santonin