loxoprofen


loxoprofen
Links:🕷 ChemSpider
MeSH:Analgesics; Anti-Inflammatory Agents, Non-Steroidal; Sensory System Agents
CAS:[68767-14-6]
Formula:C15H18O3; 246.31 g/mol
InChiKey:YMBXTVYHTMGZDW-UHFFFAOYSA-N
SMILES:CC(C(O)=O)c1ccc(CC2CCCC2=O)cc1
Molecular structure of loxoprofen

Isomers

ambrosin
Molecular structure of ambrosin
irofulven
Molecular structure of irofulven
loxoprofen
Molecular structure of loxoprofen
santonin
Molecular structure of santonin