meso-tartaric acid


(2R,3S)-2,3-dihydroxybutanedioic acid; i-tartaric acid; (2R,3S)-tartaric acid; meso-tartaric acid
Links:📏 NIST, 📖 PubMed,
📖Houben-Weyl, 2. Band (Mesoweinsäure); p. 108,
CAS:[147-73-9]
Formula:C4H6O6; 150.09 g/mol
InChiKey:FEWJPZIEWOKRBE-UHFFFAOYSA-N
SMILES:OC(C(O)C(O)=O)C(O)=O
Molecular structure of meso-tartaric acid
Melting point:140 °C

Isomers

(R,R)-tartaric acid
Molecular structure of (R,R)-tartaric acid
(S,S)-tartaric acid
Molecular structure of (S,S)-tartaric acid
meso-tartaric acid
Molecular structure of meso-tartaric acid
rac-tartaric acid
Molecular structure of rac-tartaric acid