nicotinic acid N-oxide


nicotinic acid N-oxide; nicotinic acid 1-oxide
CAS:[2398-81-4]
Formula:C6H5NO3; 139.11 g/mol
InChiKey:FJCFFCXMEXZEIM-UHFFFAOYSA-N
SMILES:OC(=O)C1=C[NH++]([O-])[CH-]C=C1
Molecular structure of nicotinic acid N-oxide
Melting point:255 °C

Isomers

1,6-dihydro-6-oxo-3-pyridinecarboxylic acid
Molecular structure of 1,6-dihydro-6-oxo-3-pyridinecarboxylic acid
1-(2-furyl)-2-nitroethylene
Molecular structure of 1-(2-furyl)-2-nitroethylene
2-hydroxynicotinic acid
Molecular structure of 2-hydroxynicotinic acid
6-hydroxynicotinic acid
Molecular structure of 6-hydroxynicotinic acid
3-hydroxypicolinic acid
Molecular structure of 3-hydroxypicolinic acid
5-hydroxypicolinic acid
Molecular structure of 5-hydroxypicolinic acid
3-hydroxypyridine-2-carboxylic acid
Molecular structure of 3-hydroxypyridine-2-carboxylic acid
6-hydroxypyridine-2-carboxylic acid
Molecular structure of 6-hydroxypyridine-2-carboxylic acid
6-hydroxypyridine-3-carboxylic acid
Molecular structure of 6-hydroxypyridine-3-carboxylic acid
isonicotinic acid N-oxide
Molecular structure of isonicotinic acid N-oxide
nicotinic acid N-oxide
Molecular structure of nicotinic acid N-oxide
2-nitrophenol
Molecular structure of 2-nitrophenol
3-nitrophenol
Molecular structure of 3-nitrophenol
4-nitrophenol
Molecular structure of 4-nitrophenol
picolinic acid N-oxide
Molecular structure of picolinic acid N-oxide