papaverine


1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxyisoquinoline; papaverine
Links:📖 PubMed,
📖Houben-Weyl, 2. Band (Papaverin); p. 683,
MeSH:Enzyme Inhibitors
CAS:[58-74-2]
Formula:C20H21NO4; 339.39 g/mol
InChiKey:XQYZDYMELSJDRZ-UHFFFAOYSA-N
SMILES:COc1ccc(Cc2nccc3cc(OC)c(OC)cc23)cc1OC
Molecular structure of papaverine
Melting point:147 °C
Log10 partition octanol / water:2.95
1g dissolves in:
3.45g aniline;    12.50g pyridine;    100.00g piperidine;    193.05g tetrachloromethane;    250.00g diethylamine;    263.16g diethyl ether

Isomers

canadine
Molecular structure of canadine
papaverine
Molecular structure of papaverine