phenanthrene


phenanthracene; phenanthrene
Links:🌍 Wikipedia, 📏 NIST, ⚗️ ChemSynthesis, 📖 PubMed,
📖Houben-Weyl, 2. Band (Phenanthren); p. 87, 135, 273, 594, 723, 774,
CAS:[85-01-8]
Formula:C14H10; 178.23 g/mol
InChiKey:YNPNZTXNASCQKK-UHFFFAOYSA-N
SMILES:c1ccc2c(c1)ccc3ccccc23
Molecular structure of phenanthrene
Density:1.180 g/mL
Molar volume:151.0 mL/mol
Dielectric constant:2.72
Dipole moment:0.55 D
Melting point:99 °C
Boiling point:332 °C
Antoine equation
P(Torr) vs T(°C)
Vapour pressure vs temperature
Log10 partition octanol / water:5.73
1g dissolves in:
1.68g benzene;    2.33g diethyl ether;    3.80g carbon disulfide;    4.88g propanoic acid;    5.03g pentanoic acid;    5.41g butanoic acid;    7.14g 2-methylpropanoic acid;    10.93g hexane;    20.37g ethanol;    21.74g ethanol;    108.11g toluene;    217.39g formic acid

Isomers

anthracene
Molecular structure of anthracene
1,2-dimethyleneacenaphthene
Molecular structure of 1,2-dimethyleneacenaphthene
diphenylethyne
Molecular structure of diphenylethyne
9-methylenefluorene
Molecular structure of 9-methylenefluorene
phenanthrene
Molecular structure of phenanthrene