phenylmethanesulfonamide


benzylsulfonamide; phenylmethanesulfonamide; α-toluenesulfonamide
CAS:[4563-33-1]
Formula:C7H9NO2S; 171.22 g/mol
InChiKey:ABOYDMHGKWRPFD-UHFFFAOYSA-N
SMILES:N[S](=O)(=O)Cc1ccccc1
Molecular structure of phenylmethanesulfonamide
Melting point:103 °C
Log10 partition octanol / water:0.13

Isomers

ethyl 2-methylthiazole-4-carboxylate
Molecular structure of ethyl 2-methylthiazole-4-carboxylate
ethyl 4-methyl-1,3-thiazole-5-carboxylate
Molecular structure of ethyl 4-methyl-1,3-thiazole-5-carboxylate
2-ethyl-4-methyl-1,3-thiazole-5-carboxylic acid
Molecular structure of 2-ethyl-4-methyl-1,3-thiazole-5-carboxylic acid
methyl 3-amino-4-methylthiophene-2-carboxylate
Molecular structure of methyl 3-amino-4-methylthiophene-2-carboxylate
2-methylbenzenesulfonamide
Molecular structure of 2-methylbenzenesulfonamide
3-methylbenzenesulfonamide
Molecular structure of 3-methylbenzenesulfonamide
4-methylbenzenesulfonamide
Molecular structure of 4-methylbenzenesulfonamide
4-(methylsulfonyl)aniline
Molecular structure of 4-(methylsulfonyl)aniline
N-phenylmethanesulfonamide
Molecular structure of N-phenylmethanesulfonamide
phenylmethanesulfonamide
Molecular structure of phenylmethanesulfonamide
3-(2-thienyl)-DL-alanine
Molecular structure of 3-(2-thienyl)-DL-alanine