rac-tartaric acid


dl-tartaric acid; rac-tartaric acid; tartaric acid
Links:🌍 Wikipedia, 📏 NIST
CAS:[133-37-9]
Formula:C4H6O6; 150.09 g/mol
InChiKey:FEWJPZIEWOKRBE-UHFFFAOYSA-N
SMILES:OC(C(O)C(O)=O)C(O)=O
Molecular structure of rac-tartaric acid
Melting point:206 °C
1g dissolves in:
5.38g water

Isomers

(R,R)-tartaric acid
Molecular structure of (R,R)-tartaric acid
(S,S)-tartaric acid
Molecular structure of (S,S)-tartaric acid
meso-tartaric acid
Molecular structure of meso-tartaric acid
rac-tartaric acid
Molecular structure of rac-tartaric acid