tris(2-methylpropyl)amine


2-methyl-N,N-bis(2-methylpropyl)propan-1-amine; triisobutylamine; tris(2-methylpropyl)amine
CAS:[1116-40-1]
Formula:C12H27N; 185.35 g/mol
InChiKey:IIFFFBSAXDNJHX-UHFFFAOYSA-N
SMILES:CC(C)CN(CC(C)C)CC(C)C
Molecular structure of tris(2-methylpropyl)amine
Density:0.771 g/mL
Molar volume:240.4 mL/mol
Refractive index:1.425
Molecular refractive power:61.49 mL/mol
Melting point:-22 °C
Boiling point:179 °C
Antoine equation
P(Torr) vs T(°C)
Vapour pressure vs temperature

Isomers

dihexylamine
Molecular structure of dihexylamine
N,N-dimethyldecylamine
Molecular structure of N,N-dimethyldecylamine
dodecan-1-amine
Molecular structure of dodecan-1-amine
tributylamine
Molecular structure of tributylamine
tris(2-methylpropyl)amine
Molecular structure of tris(2-methylpropyl)amine