tubercidin


tubercidin
Links:📖 PubMed
MeSH:Antibiotics, Antineoplastic; Antimetabolites, Antineoplastic; Antineoplastic Agents; Noxae
CAS:[69-33-0]
Formula:C11H14N4O4; 266.26 g/mol
InChiKey:HDZZVAMISRMYHH-UHFFFAOYSA-N
SMILES:Nc1ncnc2n(ccc12)C3OC(CO)C(O)C3O
Molecular structure of tubercidin
Log10 partition octanol / water:-0.80

Isomers

(1,3-dimethyl-2,6-dioxopurin-7-yl)methyl propanoate
Molecular structure of (1,3-dimethyl-2,6-dioxopurin-7-yl)methyl propanoate
doxofylline
Molecular structure of doxofylline
forodesine
Molecular structure of forodesine
7-(propoxycarbonyl)theophylline
Molecular structure of 7-(propoxycarbonyl)theophylline
tubercidin
Molecular structure of tubercidin
valeraldehyde-2,4-dinitrophenylhydrazone
Molecular structure of valeraldehyde-2,4-dinitrophenylhydrazone