valeraldehyde-2,4-dinitrophenylhydrazone


valeraldehyde-2,4-DNPh; valeraldehyde-2,4-dinitrophenylhydrazone
CAS:[2057-84-3]
Formula:C11H14N4O4; 266.26 g/mol
InChiKey:XGVOZGLOQUHZBZ-UHFFFAOYSA-N
SMILES:CCCCC=NNc1ccc(cc1[N+]([O-])=O)[N+]([O-])=O
Molecular structure of valeraldehyde-2,4-dinitrophenylhydrazone
Melting point:104 °C

Isomers

(1,3-dimethyl-2,6-dioxopurin-7-yl)methyl propanoate
Molecular structure of (1,3-dimethyl-2,6-dioxopurin-7-yl)methyl propanoate
doxofylline
Molecular structure of doxofylline
forodesine
Molecular structure of forodesine
7-(propoxycarbonyl)theophylline
Molecular structure of 7-(propoxycarbonyl)theophylline
tubercidin
Molecular structure of tubercidin
valeraldehyde-2,4-dinitrophenylhydrazone
Molecular structure of valeraldehyde-2,4-dinitrophenylhydrazone