(2E)-2-methyl-2-butenedioic acid


mesaconic acid; (2E)-2-methyl-2-butenedioic acid; (E)-2-methyl-2-butenedioic acid; (E)-2-methylbut-2-enedioic acid
Links:📏 NIST, ⚗️ ChemSynthesis, 📖 PubMed,
📖Houben-Weyl, 2. Band (Mesacons√§ure); p. 303, 473, 775, 1010
CAS:[498-23-7]
Formula:C5H6O4; 130.10 g/mol
InChiKey:HNEGQIOMVPPMNR-NSCUHMNNSA-N
SMILES:CC(=C/C(O)=O)C(O)=O
Molecular structure of (2E)-2-methyl-2-butenedioic acid
Melting point:204 °C

Isomers

1,1-cyclopropanedicarboxylic acid
Molecular structure of 1,1-cyclopropanedicarboxylic acid
cis-cyclopropane-1,2-dicarboxylic acid
Molecular structure of cis-cyclopropane-1,2-dicarboxylic acid
trans-cyclopropane-1,2-dicarboxylic acid
Molecular structure of trans-cyclopropane-1,2-dicarboxylic acid
4,4-dimethyl-1,2-dioxolane-3,5-dione
Molecular structure of 4,4-dimethyl-1,2-dioxolane-3,5-dione
2,4-dioxopentanoic acid
Molecular structure of 2,4-dioxopentanoic acid
hydrogen methyl fumarate
Molecular structure of hydrogen methyl fumarate
(2E)-2-methyl-2-butenedioic acid
Molecular structure of (2E)-2-methyl-2-butenedioic acid
(2Z)-2-methyl-2-butenedioic acid
Molecular structure of (2Z)-2-methyl-2-butenedioic acid
2-methylidenebutanedioic acid
Molecular structure of 2-methylidenebutanedioic acid
(R)-(-)-5-oxo-2-tetrahydrofurancarboxylic acid
Molecular structure of (R)-(-)-5-oxo-2-tetrahydrofurancarboxylic acid
(S)-(+)-5-oxo-2-tetrahydrofurancarboxylic acid
Molecular structure of (S)-(+)-5-oxo-2-tetrahydrofurancarboxylic acid
(E)-pent-2-enedioic acid
Molecular structure of (E)-pent-2-enedioic acid