(2S)-2-[[N'-[(4S)-4-amino-5-hydroxy-5-oxopentyl]carbamimidoyl]amino]butanedioic acid


N-[{[(4S)-4-amino-4-carboxybutyl]amino}(imino)methyl]-L-aspartic acid; (2S)-2-[[N'-[(4S)-4-amino-5-hydroxy-5-oxopentyl]carbamimidoyl]amino]butanedioic acid; L-argininosuccinic acid
CAS:[2387-71-5]
Formula:C10H18N4O6; 290.28 g/mol
InChiKey:KDZOASGQNOPSCU-WDSKDSINSA-N
SMILES:N[C@@H](CCCN=C(N)N[C@@H](CC(O)=O)C(O)=O)C(O)=O
Molecular structure of (2S)-2-[[N'-[(4S)-4-amino-5-hydroxy-5-oxopentyl]carbamimidoyl]amino]butanedioic acid