(E)-1-(4-methoxyphenyl)-3-phenylprop-2-en-1-one


4'-methoxychalcone; (E)-1-(4-methoxyphenyl)-3-phenylprop-2-en-1-one
Links:🕷 ChemSpider, 📖 PubMed
CAS:[959-23-9]
Formula:C16H14O2; 238.29 g/mol
InChiKey:KJHHAPASNNVTSN-KPKJPENVSA-N
SMILES:COc1ccc(cc1)C(=O)C=Cc2ccccc2
Molecular structure of (E)-1-(4-methoxyphenyl)-3-phenylprop-2-en-1-one
Dipole moment:3.47 D
Melting point:102 °C

Isomers

benzyl (Z)-3-phenylprop-2-enoate
Molecular structure of benzyl (Z)-3-phenylprop-2-enoate
bicyclo[4.2.0]octa-1,3,5-trien-7-yl phenylacetate
Molecular structure of bicyclo[4.2.0]octa-1,3,5-trien-7-yl phenylacetate
1,2-bis(4-methylphenyl)ethane-1,2-dione
Molecular structure of 1,2-bis(4-methylphenyl)ethane-1,2-dione
cinnamyl benzoate
Molecular structure of cinnamyl benzoate
4,4'-diacetylbiphenyl
Molecular structure of 4,4'-diacetylbiphenyl
1,2-dibenzoylethane
Molecular structure of 1,2-dibenzoylethane
9,10-dimethoxyanthracene
Molecular structure of 9,10-dimethoxyanthracene
1,2-dimethoxyphenanthrene
Molecular structure of 1,2-dimethoxyphenanthrene
1,6-dimethoxyphenanthrene
Molecular structure of 1,6-dimethoxyphenanthrene
2,3-dimethoxyphenanthrene
Molecular structure of 2,3-dimethoxyphenanthrene
2,6-dimethoxyphenanthrene
Molecular structure of 2,6-dimethoxyphenanthrene
2,7-dimethoxyphenanthrene
Molecular structure of 2,7-dimethoxyphenanthrene
3,4-dimethoxyphenanthrene
Molecular structure of 3,4-dimethoxyphenanthrene
3,6-dimethoxyphenanthrene
Molecular structure of 3,6-dimethoxyphenanthrene
1,4-diphenylbutane-2,3-dione
Molecular structure of 1,4-diphenylbutane-2,3-dione
2,3-di(phenyl)-5,6-dihydro-1,4-dioxine
Molecular structure of 2,3-di(phenyl)-5,6-dihydro-1,4-dioxine
2-(7-hydroxybicyclo[4.2.0]octa-1,3,5-trien-7-yl)-1-phenylethanone
Molecular structure of 2-(7-hydroxybicyclo[4.2.0]octa-1,3,5-trien-7-yl)-1-phenylethanone
1-methoxy-4-[(4-methoxyphenyl)ethynyl]benzene
Molecular structure of 1-methoxy-4-[(4-methoxyphenyl)ethynyl]benzene
(E)-1-(4-methoxyphenyl)-3-phenylprop-2-en-1-one
Molecular structure of (E)-1-(4-methoxyphenyl)-3-phenylprop-2-en-1-one
(E)-3-(4-methoxyphenyl)-1-phenylprop-2-en-1-one
Molecular structure of (E)-3-(4-methoxyphenyl)-1-phenylprop-2-en-1-one
2-methyl-3,3-diphenylprop-2-enoic acid
Molecular structure of 2-methyl-3,3-diphenylprop-2-enoic acid
7-phenylbicyclo[4.2.0]octa-1,3,5-trien-7-yl acetate
Molecular structure of 7-phenylbicyclo[4.2.0]octa-1,3,5-trien-7-yl acetate
2-[(E)-2-phenylethenyl]phenyl acetate
Molecular structure of 2-[(E)-2-phenylethenyl]phenyl acetate
1-phenyl-3-(4-methoxyphenyl)-2-propen-1-one
Molecular structure of 1-phenyl-3-(4-methoxyphenyl)-2-propen-1-one
phenylmethyl (E)-3-phenylprop-2-enoate
Molecular structure of phenylmethyl (E)-3-phenylprop-2-enoate
4-[4-(prop-2-yn-1-yloxy)benzyl]phenol
Molecular structure of 4-[4-(prop-2-yn-1-yloxy)benzyl]phenol