(E)-1-(4-methylphenyl)-2-phenylethene


(E)-1-(4-methylphenyl)-2-phenylethene; 4-methylstilbene; 1-phenyl-2-p-tolylethene; trans-1-phenyl-2-p-tolylethene
CAS:[4714-21-0]
Formula:C15H14; 194.28 g/mol
InChiKey:MDRVHDXASYPUCB-VAWYXSNFSA-N
SMILES:Cc1ccc(cc1)C=Cc2ccccc2
Molecular structure of (E)-1-(4-methylphenyl)-2-phenylethene
Dipole moment:0.34 D
Melting point:120 °C

Isomers

cyclopentano[def]-1,2,3,4-tetrahydrophenanthrene
Molecular structure of cyclopentano[def]-1,2,3,4-tetrahydrophenanthrene
cyclopentano[gh]phenalan
Molecular structure of cyclopentano[gh]phenalan
1-(1-cyclopentenyl)naphthalene
Molecular structure of 1-(1-cyclopentenyl)naphthalene
2-(cyclopenten-1-yl)naphthalene
Molecular structure of 2-(cyclopenten-1-yl)naphthalene
2,3-dimethylfluorene
Molecular structure of 2,3-dimethylfluorene
2,5-dimethylfluorene
Molecular structure of 2,5-dimethylfluorene
2,6-dimethylfluorene
Molecular structure of 2,6-dimethylfluorene
2,7-dimethylfluorene
Molecular structure of 2,7-dimethylfluorene
3,5-dimethylfluorene
Molecular structure of 3,5-dimethylfluorene
9,9-dimethylfluorene
Molecular structure of 9,9-dimethylfluorene
1,1-diphenylpropene
Molecular structure of 1,1-diphenylpropene
(E)-1,2-diphenylpropene
Molecular structure of (E)-1,2-diphenylpropene
(Z)-1,2-diphenylpropene
Molecular structure of (Z)-1,2-diphenylpropene
2,3-diphenylpropene
Molecular structure of 2,3-diphenylpropene
3,3-diphenylpropene
Molecular structure of 3,3-diphenylpropene
9-ethylfluorene
Molecular structure of 9-ethylfluorene
2-methyl-9,10-dihydroanthracene
Molecular structure of 2-methyl-9,10-dihydroanthracene
9-methyl-9,10-dihydroanthracene
Molecular structure of 9-methyl-9,10-dihydroanthracene
1-methyl-3,4-dihydrophenanthrene
Molecular structure of 1-methyl-3,4-dihydrophenanthrene
(E)-1-(3-methylphenyl)-2-phenylethene
Molecular structure of (E)-1-(3-methylphenyl)-2-phenylethene
(E)-1-(4-methylphenyl)-2-phenylethene
Molecular structure of (E)-1-(4-methylphenyl)-2-phenylethene
[(E)-1-phenylprop-1-en-2-yl]benzene
Molecular structure of [(E)-1-phenylprop-1-en-2-yl]benzene