(Z)-octadec-9-enoic acid


(9Z)-octadec-9-enoic acid; (Z)-9-octadecenoic acid; (Z)-octadec-9-enoic acid; cis-9-octadecenoic acid; oleic acid; oleinic acid
Links:🌍 Wikipedia, 📏 NIST, 📖 PubMed,
📖Houben-Weyl, 2. Band (Ölsäure); p. 131, 247, 267, 269, 474, 770, 771, 775, 793, 806, 990
CAS:[112-80-1]
Formula:C18H34O2; 282.47 g/mol
InChiKey:ZQPPMHVWECSIRJ-KTKRTIGZSA-N
SMILES:CCCCCCCCC=C/CCCCCCCC(O)=O
Molecular structure of (Z)-octadec-9-enoic acid
Use:oiling of wool; oleates; polishing compounds; soap stock
Density:0.895 g/mL
Molar volume:315.6 mL/mol
Refractive index:1.463
Molecular refractive power:86.93 mL/mol
Dielectric constant:2.46
Dipole moment:1.18 D
Melting point:14 °C
Boiling point:360 °C
Antoine equation
P(Torr) vs T(°C)
Vapour pressure vs temperature
Log10 partition octanol / water:7.64
Hansen solubility parameter:δd: 7.0 (cal/mL)½   δp: 1.5 (cal/mL)½   δh: 7.0 (cal/mL)½

Isomers

(Z)-octadec-11-enoic acid
Molecular structure of (Z)-octadec-11-enoic acid
(E)-octadec-9-enoic acid
Molecular structure of (E)-octadec-9-enoic acid
(Z)-octadec-9-enoic acid
Molecular structure of (Z)-octadec-9-enoic acid
petroselinic acid
Molecular structure of petroselinic acid
tetradecyl 2-methylprop-2-enoate
Molecular structure of tetradecyl 2-methylprop-2-enoate
vaccenic acid
Molecular structure of vaccenic acid