(4-methylphenyl)urea


1-(4-methylphenyl)urea; (4-methylphenyl)urea; p-tolylcarbamide; p-tolylurea
Links:📖 PubMed
CAS:[622-51-5]
Formula:C8H10N2O; 150.18 g/mol
InChiKey:DMSHKWHLXNDUST-UHFFFAOYSA-N
SMILES:Cc1ccc(NC(N)=O)cc1
Molecular structure of (4-methylphenyl)urea
Melting point:183 °C
1g dissolves in:
36.63g 2-propanone;    325.73g water;    1,612.90g diethyl ether;    2,325.58g benzene

Isomers

2-acetamidoaniline
Molecular structure of 2-acetamidoaniline
2-acetyl-3-ethylpyrazine
Molecular structure of 2-acetyl-3-ethylpyrazine
1-acetyl-2-phenylhydrazine
Molecular structure of 1-acetyl-2-phenylhydrazine
2-aminoacetanilide
Molecular structure of 2-aminoacetanilide
4-aminoacetanilide
Molecular structure of 4-aminoacetanilide
3-amino-4-methylbenzamide
Molecular structure of 3-amino-4-methylbenzamide
4-amino-N-methylbenzamide
Molecular structure of 4-amino-N-methylbenzamide
benzylurea
Molecular structure of benzylurea
N,N-dimethylpyridine-3-carboxamide
Molecular structure of N,N-dimethylpyridine-3-carboxamide
N-ethyl-N-phenylnitrous amide
Molecular structure of N-ethyl-N-phenylnitrous amide
N-ethylpyridine-3-carboxamide
Molecular structure of N-ethylpyridine-3-carboxamide
2-methylbenzamide oxime
Molecular structure of 2-methylbenzamide oxime
3-methylbenzamide oxime
Molecular structure of 3-methylbenzamide oxime
4-methylbenzamide oxime
Molecular structure of 4-methylbenzamide oxime
2-methylbenzohydrazide
Molecular structure of 2-methylbenzohydrazide
3-methylbenzohydrazide
Molecular structure of 3-methylbenzohydrazide
4-methylbenzohydrazide
Molecular structure of 4-methylbenzohydrazide
N-methyl-N-(phenylmethyl)nitrous amide
Molecular structure of N-methyl-N-(phenylmethyl)nitrous amide
1-methyl-1-phenylurea
Molecular structure of 1-methyl-1-phenylurea
1-(3-methylphenyl)urea
Molecular structure of 1-(3-methylphenyl)urea
(2-methylphenyl)urea
Molecular structure of (2-methylphenyl)urea
(4-methylphenyl)urea
Molecular structure of (4-methylphenyl)urea
4-nitroso-N,N-dimethylaniline
Molecular structure of 4-nitroso-N,N-dimethylaniline
phenylacetic acid hydrazide
Molecular structure of phenylacetic acid hydrazide
N-phenylacetohydrazide
Molecular structure of N-phenylacetohydrazide
3-pyridin-2-ylpropanamide
Molecular structure of 3-pyridin-2-ylpropanamide
3-pyridin-3-ylpropanamide
Molecular structure of 3-pyridin-3-ylpropanamide
3-pyridin-4-ylpropanamide
Molecular structure of 3-pyridin-4-ylpropanamide