(7-diethylaminophenoxazin-3-ylidene)-diethylazanium chloride


basic blue 3; bleu de Lyon; bleu lumiere; (7-diethylaminophenoxazin-3-ylidene)-diethylazanium chloride; diphenylamine blue; solvent blue 3
Links:🕷 ChemSpider, 📖 PubMed
CAS:[33203-82-6]
Formula:C20H26ClN3O; 359.90 g/mol
InChiKey:IURGIPVDZKDLIX-UHFFFAOYSA-M
SMILES:[Cl-].CCN(CC)c1ccc2N=C3C=CC(C=C3Oc2c1)=[N+](CC)CC
Molecular structure of (7-diethylaminophenoxazin-3-ylidene)-diethylazanium chloride
Melting point:205 °C
1g dissolves in:
253.16g aniline;    259.74g methanol;    434.78g ethanol;    564.97g 2-propanone;    2,040.82g pentanol