1,3,5-benzenetricarboxylic acid


1,3,5-benzenetricarboxylic acid; benzene-1,3,5-tricarboxylic acid; trimesic acid
Links:⚗️ ChemSynthesis, 📖 PubMed,
📖Org. Chem., v. Richter, 1. Vol (Trimesic Acid); p. 303, 401, 615
CAS RN:[554-95-0]
Formula:C9H6O6; 210.14 g/mol
InChiKey:QMKYBPDZANOJGF-UHFFFAOYSA-N
SMILES:OC(=O)c1cc(cc(c1)C(O)=O)C(O)=O
Molecular structure of 1,3,5-benzenetricarboxylic acid
Dipole moment:3.65 D
Melting point:380 °C

Isomers

benzene-1,2,3-tricarboxylic acid
Molecular structure of benzene-1,2,3-tricarboxylic acid
benzene-1,2,4-tricarboxylic acid
Molecular structure of benzene-1,2,4-tricarboxylic acid
1,3,5-benzenetricarboxylic acid
Molecular structure of 1,3,5-benzenetricarboxylic acid
hydrastic acid
Molecular structure of hydrastic acid