1,2-dihydroxy-9,10-anthracenedione


alizarin; alizarine; C.I. 58000; 1,2-dihydroxy-9,10-anthracenedione; 1,2-dihydroxyanthracene-9,10-dione; 1,2-dihydroxy-9,10-anthraquinone; mordant red 11
Links:🌍 Wikipedia, 📏 NIST, 📖 PubMed,
📖Houben-Weyl, 2. Band (Alizarin); p. 58, 95, 224, 236, 438, 895
CAS:[72-48-0]
Formula:C14H8O4; 240.22 g/mol
InChiKey:RGCKGOZRHPZPFP-UHFFFAOYSA-N
SMILES:Oc1ccc2C(=O)c3ccccc3C(=O)c2c1O
Molecular structure of 1,2-dihydroxy-9,10-anthracenedione
Colour:
Melting point:290 °C
Boiling point:430 °C
1g dissolves in:
166,666.67g water

Isomers

dantron
Molecular structure of dantron
1,2-dihydroxy-9,10-anthracenedione
Molecular structure of 1,2-dihydroxy-9,10-anthracenedione
1,5-dihydroxyanthracene-9,10-dione
Molecular structure of 1,5-dihydroxyanthracene-9,10-dione
2,6-dihydroxyanthracene-9,10-dione
Molecular structure of 2,6-dihydroxyanthracene-9,10-dione
2,7-dihydroxy-9,10-anthracenedione
Molecular structure of 2,7-dihydroxy-9,10-anthracenedione
1,4-dihydroxyanthraquinone
Molecular structure of 1,4-dihydroxyanthraquinone