1,4-dihydroxyanthraquinone


chinizarin; C.I. pigment violet 12; 1,4-dihydroxy-9,10-anthracenedione; 1,4-dihydroxyanthracene-9,10-dione; 1,4-dihydroxyanthraquinone; 1,4-dihydroxy-9,10-dihydroanthracene-9,10-dione; quinizarin
Links:📏 NIST, 📖 PubMed
CAS:[81-64-1]
Formula:C14H8O4; 240.22 g/mol
InChiKey:GUEIZVNYDFNHJU-UHFFFAOYSA-N
SMILES:Oc1ccc(O)c2C(=O)c3ccccc3C(=O)c12
Molecular structure of 1,4-dihydroxyanthraquinone
Melting point:201 °C
Boiling point:450 °C
1g dissolves in:
83,333,333.33g water

Isomers

dantron
Molecular structure of dantron
1,2-dihydroxy-9,10-anthracenedione
Molecular structure of 1,2-dihydroxy-9,10-anthracenedione
1,5-dihydroxyanthracene-9,10-dione
Molecular structure of 1,5-dihydroxyanthracene-9,10-dione
2,6-dihydroxyanthracene-9,10-dione
Molecular structure of 2,6-dihydroxyanthracene-9,10-dione
2,7-dihydroxy-9,10-anthracenedione
Molecular structure of 2,7-dihydroxy-9,10-anthracenedione
1,4-dihydroxyanthraquinone
Molecular structure of 1,4-dihydroxyanthraquinone