1,5-dihydroxyanthracene-9,10-dione


anthrarufin; anthrarufine; 1,5-dihydroxyanthracene-9,10-dione; 1,5-dihydroxyanthraquinone
Links:📏 NIST, 📖 PubMed
CAS:[117-12-4]
Formula:C14H8O4; 240.22 g/mol
InChiKey:JPICKYUTICNNNJ-UHFFFAOYSA-N
SMILES:Oc1cccc2C(=O)c3c(O)cccc3C(=O)c12
Molecular structure of 1,5-dihydroxyanthracene-9,10-dione
Melting point:280 °C
1g dissolves in:
3,508,771.93g water

Isomers

dantron
Molecular structure of dantron
1,2-dihydroxy-9,10-anthracenedione
Molecular structure of 1,2-dihydroxy-9,10-anthracenedione
1,5-dihydroxyanthracene-9,10-dione
Molecular structure of 1,5-dihydroxyanthracene-9,10-dione
2,6-dihydroxyanthracene-9,10-dione
Molecular structure of 2,6-dihydroxyanthracene-9,10-dione
2,7-dihydroxy-9,10-anthracenedione
Molecular structure of 2,7-dihydroxy-9,10-anthracenedione
1,4-dihydroxyanthraquinone
Molecular structure of 1,4-dihydroxyanthraquinone