1-hydroxyanthracene-9,10-dione


1-hydroxyanthracene-9,10-dione; 1-hydroxyanthraquinone; α-hydroxyanthraquinone
Links:📏 NIST, 🕷 ChemSpider, 📖 PubMed
CAS:[129-43-1]
Formula:C14H8O3; 224.22 g/mol
InChiKey:BTLXPCBPYBNQNR-UHFFFAOYSA-N
SMILES:Oc1cccc2C(=O)c3ccccc3C(=O)c12
Molecular structure of 1-hydroxyanthracene-9,10-dione
Melting point:194 °C
Log10 partition octanol / water:3.52
1g dissolves in:
285,714.29g water

Isomers

diphenic anhydride
Molecular structure of diphenic anhydride
9-fluorenone-1-carboxylic acid
Molecular structure of 9-fluorenone-1-carboxylic acid
9-fluorenone-2-carboxylic acid
Molecular structure of 9-fluorenone-2-carboxylic acid
1-hydroxyanthracene-9,10-dione
Molecular structure of 1-hydroxyanthracene-9,10-dione
2-hydroxyanthracene-9,10-dione
Molecular structure of 2-hydroxyanthracene-9,10-dione
9-oxofluorene-4-carboxylic acid
Molecular structure of 9-oxofluorene-4-carboxylic acid