1-methyl-1-phenylurea


as-methylphenylcarbamide; 1-methyl-1-phenylurea
Links:📏 NIST, 🕷 ChemSpider
CAS:[4559-87-9]
Formula:C8H10N2O; 150.18 g/mol
InChiKey:SKAADKSETAYKGL-UHFFFAOYSA-N
SMILES:CN(C(N)=O)c1ccccc1
Molecular structure of 1-methyl-1-phenylurea
1g dissolves in:
0.35g water;    2.40g 2-propanone;    7.09g benzene;    42.92g diethyl ether

Isomers

2-acetamidoaniline
Molecular structure of 2-acetamidoaniline
2-acetyl-3-ethylpyrazine
Molecular structure of 2-acetyl-3-ethylpyrazine
1-acetyl-2-phenylhydrazine
Molecular structure of 1-acetyl-2-phenylhydrazine
2-aminoacetanilide
Molecular structure of 2-aminoacetanilide
4-aminoacetanilide
Molecular structure of 4-aminoacetanilide
3-amino-4-methylbenzamide
Molecular structure of 3-amino-4-methylbenzamide
4-amino-N-methylbenzamide
Molecular structure of 4-amino-N-methylbenzamide
benzylurea
Molecular structure of benzylurea
N,N-dimethylpyridine-3-carboxamide
Molecular structure of N,N-dimethylpyridine-3-carboxamide
N-ethyl-N-phenylnitrous amide
Molecular structure of N-ethyl-N-phenylnitrous amide
N-ethylpyridine-3-carboxamide
Molecular structure of N-ethylpyridine-3-carboxamide
2-methylbenzamide oxime
Molecular structure of 2-methylbenzamide oxime
3-methylbenzamide oxime
Molecular structure of 3-methylbenzamide oxime
4-methylbenzamide oxime
Molecular structure of 4-methylbenzamide oxime
2-methylbenzohydrazide
Molecular structure of 2-methylbenzohydrazide
3-methylbenzohydrazide
Molecular structure of 3-methylbenzohydrazide
4-methylbenzohydrazide
Molecular structure of 4-methylbenzohydrazide
N-methyl-N-(phenylmethyl)nitrous amide
Molecular structure of N-methyl-N-(phenylmethyl)nitrous amide
1-methyl-1-phenylurea
Molecular structure of 1-methyl-1-phenylurea
1-(3-methylphenyl)urea
Molecular structure of 1-(3-methylphenyl)urea
(2-methylphenyl)urea
Molecular structure of (2-methylphenyl)urea
(4-methylphenyl)urea
Molecular structure of (4-methylphenyl)urea
4-nitroso-N,N-dimethylaniline
Molecular structure of 4-nitroso-N,N-dimethylaniline
phenylacetic acid hydrazide
Molecular structure of phenylacetic acid hydrazide
N-phenylacetohydrazide
Molecular structure of N-phenylacetohydrazide
3-pyridin-2-ylpropanamide
Molecular structure of 3-pyridin-2-ylpropanamide
3-pyridin-3-ylpropanamide
Molecular structure of 3-pyridin-3-ylpropanamide
3-pyridin-4-ylpropanamide
Molecular structure of 3-pyridin-4-ylpropanamide