2,2,4-trimethylpentan-3-one


isopropyl tert-butyl ketone; isopropyl t-butyl ketone; 2,2,4-trimethyl-3-pentanone; 2,2,4-trimethylpentan-3-one
Links:📏 NIST, 🕷 ChemSpider, ⚗️ ChemSynthesis
CAS:[5857-36-3]
Formula:C8H16O; 128.21 g/mol
InChiKey:OVCHQRXVZXVQNQ-UHFFFAOYSA-N
SMILES:CC(C)C(=O)C(C)(C)C
Molecular structure of 2,2,4-trimethylpentan-3-one
Boiling point:135 °C
Antoine equation
P(Torr) vs T(°C)
Vapour pressure vs temperature

Isomers

cis,cis-2,6-dimethylcyclohexanol
Molecular structure of cis,cis-2,6-dimethylcyclohexanol
1-cyclohexylethanol
Molecular structure of 1-cyclohexylethanol
2-cyclohexylethanol
Molecular structure of 2-cyclohexylethanol
cyclooctanol
Molecular structure of cyclooctanol
3-cyclopentyl-1-propanol
Molecular structure of 3-cyclopentyl-1-propanol
1,3-dimethylcyclohexanol
Molecular structure of 1,3-dimethylcyclohexanol
2,2-dimethylcyclohexanol
Molecular structure of 2,2-dimethylcyclohexanol
cis,trans-2,6-dimethylcyclohexanol
Molecular structure of cis,trans-2,6-dimethylcyclohexanol
(2R,6R)-2,6-dimethylcyclohexan-1-ol
Molecular structure of (2R,6R)-2,6-dimethylcyclohexan-1-ol
3,3-dimethylcyclohexanol
Molecular structure of 3,3-dimethylcyclohexanol
cis-3,5-dimethylcyclohexanol
Molecular structure of cis-3,5-dimethylcyclohexanol
trans-3,5-dimethylcyclohexanol
Molecular structure of trans-3,5-dimethylcyclohexanol
4,4-dimethylcyclohexanol
Molecular structure of 4,4-dimethylcyclohexanol
2,2-dimethyl-3-hexanone
Molecular structure of 2,2-dimethyl-3-hexanone
2,2-dimethyl-5-hexen-3-ol
Molecular structure of 2,2-dimethyl-5-hexen-3-ol
3,5-dimethyl-2-hexen-4-ol
Molecular structure of 3,5-dimethyl-2-hexen-4-ol
2-(2,2-dimethylpropyl)-2-methyloxirane
Molecular structure of 2-(2,2-dimethylpropyl)-2-methyloxirane
1,2-epoxyoctane
Molecular structure of 1,2-epoxyoctane
ethoxycyclohexane
Molecular structure of ethoxycyclohexane
1-ethylcyclohexanol
Molecular structure of 1-ethylcyclohexanol
2-ethylhexanal
Molecular structure of 2-ethylhexanal
3-ethyl-5-hexen-3-ol
Molecular structure of 3-ethyl-5-hexen-3-ol
cis-2-ethyl-3-methyltetrahydropyran
Molecular structure of cis-2-ethyl-3-methyltetrahydropyran
trans-2-Ethyl-3-methyltetrahydropyran
Molecular structure of trans-2-Ethyl-3-methyltetrahydropyran
1-methylcycloheptanol
Molecular structure of 1-methylcycloheptanol
2-methyl-3-heptanone
Molecular structure of 2-methyl-3-heptanone
2-methylheptan-4-one
Molecular structure of 2-methylheptan-4-one
3-methylheptan-2-one
Molecular structure of 3-methylheptan-2-one
5-methyl-3-heptanone
Molecular structure of 5-methyl-3-heptanone
6-methylheptan-2-one
Molecular structure of 6-methylheptan-2-one
6-methylheptan-3-one
Molecular structure of 6-methylheptan-3-one
4-methyl-1-hepten-4-ol
Molecular structure of 4-methyl-1-hepten-4-ol
(R)-(-)-6-methyl-5-hepten-2-ol
Molecular structure of (R)-(-)-6-methyl-5-hepten-2-ol
(S)-(+)-6-methyl-5-hepten-2-ol
Molecular structure of (S)-(+)-6-methyl-5-hepten-2-ol
6-methyl-5-hepten-2-ol
Molecular structure of 6-methyl-5-hepten-2-ol
octanal
Molecular structure of octanal
2-octanone
Molecular structure of 2-octanone
3-octanone
Molecular structure of 3-octanone
1-octen-3-ol
Molecular structure of 1-octen-3-ol
1-octen-4-ol
Molecular structure of 1-octen-4-ol
(E)-2-octen-1-ol
Molecular structure of (E)-2-octen-1-ol
trans-2-octen-1-ol
Molecular structure of trans-2-octen-1-ol
cis-3-octen-1-ol
Molecular structure of cis-3-octen-1-ol
(5E)-5-octen-1-ol
Molecular structure of (5E)-5-octen-1-ol
cis-5-octen-1-ol
Molecular structure of cis-5-octen-1-ol
oct-7-en-1-ol
Molecular structure of oct-7-en-1-ol
pentoxycyclopropane
Molecular structure of pentoxycyclopropane
2-propan-2-yloxane
Molecular structure of 2-propan-2-yloxane
2,2,5,5-tetramethyltetrahydrofuran
Molecular structure of 2,2,5,5-tetramethyltetrahydrofuran
trans,trans-2,6-dimethylcyclohexanol
Molecular structure of trans,trans-2,6-dimethylcyclohexanol
2,2,4-trimethylpentan-3-one
Molecular structure of 2,2,4-trimethylpentan-3-one