2,5-dihydroxybenzoic acid


carboxyhydroquinone; 2,5-dihydroxybenzoic acid; gentianic acid; gentisic acid; hydroquinonecarboxylic acid; 5-hydroxysalicylic acid
Links:📏 NIST, ⚗️ ChemSynthesis, 📖 PubMed,
📖Houben-Weyl, 2. Band (Gentisins√§ure); p. 985
CAS RN:[490-79-9]
Formula:C7H6O4; 154.12 g/mol
InChiKey:WXTMDXOMEHJXQO-UHFFFAOYSA-N
SMILES:OC(=O)c1cc(O)ccc1O
Molecular structure of 2,5-dihydroxybenzoic acid
Melting point:205 °C
Log10 partition octanol / water:1.61

Isomers

2,3-dihydroxybenzoic acid
Molecular structure of 2,3-dihydroxybenzoic acid
2,4-dihydroxybenzoic acid
Molecular structure of 2,4-dihydroxybenzoic acid
2,5-dihydroxybenzoic acid
Molecular structure of 2,5-dihydroxybenzoic acid
2,6-dihydroxybenzoic acid
Molecular structure of 2,6-dihydroxybenzoic acid
3,4-dihydroxybenzoic acid
Molecular structure of 3,4-dihydroxybenzoic acid
3,5-dihydroxybenzoic acid
Molecular structure of 3,5-dihydroxybenzoic acid
methyl 2-oxo-2H-pyran-3-carboxylate
Molecular structure of methyl 2-oxo-2H-pyran-3-carboxylate
methyl 6-oxopyran-3-carboxylate
Molecular structure of methyl 6-oxopyran-3-carboxylate
patulin
Molecular structure of patulin
terreic acid
Molecular structure of terreic acid
2,3,4-trihydroxybenzaldehyde
Molecular structure of 2,3,4-trihydroxybenzaldehyde
2,4,5-trihydroxybenzaldehyde
Molecular structure of 2,4,5-trihydroxybenzaldehyde
2,4,6-trihydroxybenzaldehyde
Molecular structure of 2,4,6-trihydroxybenzaldehyde
3,4,5-trihydroxybenzaldehyde
Molecular structure of 3,4,5-trihydroxybenzaldehyde