2,4,6-trinitrotoluene


2-methyl-1,3,5-trinitrobenzene; TNT; trinitrotoluene; α-trinitrotoluene; 2,4,6-trinitrotoluene; trotyl
Links:🌍 Wikipedia, 📖 PubMed
CAS:[118-96-7]
Formula:C7H5N3O6; 227.13 g/mol
InChiKey:SPSSULHKWOKEEL-UHFFFAOYSA-N
SMILES:Cc1c(cc(cc1[N+]([O-])=O)[N+]([O-])=O)[N+]([O-])=O
Molecular structure of 2,4,6-trinitrotoluene
Density:1.654 g/mL
Molar volume:137.3 mL/mol
Dipole moment:1.00 D
Melting point:80 °C
Boiling point:240 °C
Log10 partition octanol / water:1.60
1g dissolves in:
62.50g ethanol;    4,761.90g water

Isomers

1-methyl-2,3,4-trinitrobenzene
Molecular structure of 1-methyl-2,3,4-trinitrobenzene
1-methyl-2,3,5-trinitrobenzene
Molecular structure of 1-methyl-2,3,5-trinitrobenzene
1-methyl-2,4,5-trinitrobenzene
Molecular structure of 1-methyl-2,4,5-trinitrobenzene
2-methyl-1,3,4-trinitrobenzene
Molecular structure of 2-methyl-1,3,4-trinitrobenzene
5-methyl-1,2,3-trinitrobenzene
Molecular structure of 5-methyl-1,2,3-trinitrobenzene
2,4,6-trinitrotoluene
Molecular structure of 2,4,6-trinitrotoluene