2-(3,5,6-trichloropyridin-2-yl)oxyacetic acid


; ; ; 2-(3,5,6-trichloropyridin-2-yl)oxyacetic acid
Links:📏 NIST, 🕷 ChemSpider, 📖 PubMed
MeSH:Herbicides; Pesticides
CAS RN:[55335-06-3]
Formula:C7H4Cl3NO3; 256.47 g/mol
InChiKey:REEQLXCGVXDJSQ-UHFFFAOYSA-N
SMILES:OC(=O)COc1nc(Cl)c(Cl)cc1Cl
Molecular structure of 2-(3,5,6-trichloropyridin-2-yl)oxyacetic acid
Melting point:149 °C