2-(phenylamino)benzoic acid


fenamic acid; N-phenyl-o-aminobenzoic acid; 2-(phenylamino)benzoic acid; N-phenylanthranilic acid
Links:🌍 Wikipedia, 🕷 ChemSpider, 📖 PubMed,
📖Houben-Weyl, 2. Band (Phenylanthranils√§ure); p. 452
MeSH:Analgesics; Anti-Inflammatory Agents, Non-Steroidal; Sensory System Agents; Analgesics; Anti-Inflammatory Agents, Non-Steroidal; Sensory System Agents
CAS RN:[91-40-7]
Formula:C13H11NO2; 213.24 g/mol
InChiKey:ZWJINEZUASEZBH-UHFFFAOYSA-N
SMILES:OC(=O)c1ccccc1Nc2ccccc2
Molecular structure of 2-(phenylamino)benzoic acid
Melting point:187 °C
Log10 partition octanol / water:4.36

Isomers

allyl quinoline-8-carboxylate
Molecular structure of allyl quinoline-8-carboxylate
3-amino-2-methoxydibenzofuran
Molecular structure of 3-amino-2-methoxydibenzofuran
N-benzoyl-N-phenylhydroxylamine
Molecular structure of N-benzoyl-N-phenylhydroxylamine
benzyl nicotinate
Molecular structure of benzyl nicotinate
2,4-dioxo-6-phenylcyclohexanecarbonitrile
Molecular structure of 2,4-dioxo-6-phenylcyclohexanecarbonitrile
4-[(hydroxyimino)(phenyl)methyl]phenol
Molecular structure of 4-[(hydroxyimino)(phenyl)methyl]phenol
2-hydroxy-N-phenylbenzamide
Molecular structure of 2-hydroxy-N-phenylbenzamide
N-(4-hydroxyphenyl)benzamide
Molecular structure of N-(4-hydroxyphenyl)benzamide
4-(2-methoxybenzoyl)pyridine
Molecular structure of 4-(2-methoxybenzoyl)pyridine
4-(4-methoxybenzoyl)pyridine
Molecular structure of 4-(4-methoxybenzoyl)pyridine
6-(4-methoxyphenyl)-2-pyridinecarboxaldehyde
Molecular structure of 6-(4-methoxyphenyl)-2-pyridinecarboxaldehyde
4-(2-naphthalenyloxy)-2-azetidinone
Molecular structure of 4-(2-naphthalenyloxy)-2-azetidinone
(3E)-3-(2-oxocyclopentylidene)-1,3-dihydro-2H-indol-2-one
Molecular structure of (3E)-3-(2-oxocyclopentylidene)-1,3-dihydro-2H-indol-2-one
2-(4-pentynyl)isoindole-1,3-dione
Molecular structure of 2-(4-pentynyl)isoindole-1,3-dione
2-(phenylamino)benzoic acid
Molecular structure of 2-(phenylamino)benzoic acid
phenyl phenylcarbamate
Molecular structure of phenyl phenylcarbamate
1-phthalimido-2-pentyne
Molecular structure of 1-phthalimido-2-pentyne