2-bromobutanedioic acid


(±)-bromobutanedioic acid; rac-bromobutanedioic acid; 2-bromobutanedioic acid; bromosuccinic acid; monobromosuccinic acid
Links:🕷 ChemSpider
CAS:[923-06-8]
Formula:C4H5BrO4; 196.99 g/mol
InChiKey:QQWGVQWAEANRTK-UHFFFAOYSA-N
SMILES:OC(=O)CC(Br)C(O)=O
Molecular structure of 2-bromobutanedioic acid
Melting point:161 °C
1g dissolves in:
0.77g methanol;    1.20g ethanol;    2.02g propanol