2-hydroxyanthracene-9,10-dione


2-hydroxyanthracene-9,10-dione; 2-hydroxyanthraquinone; β-hydroxyanthraquinone
Links:📏 NIST, 🕷 ChemSpider, 📖 PubMed
CAS:[605-32-3]
Formula:C14H8O3; 224.22 g/mol
InChiKey:GCDBEYOJCZLKMC-UHFFFAOYSA-N
SMILES:Oc1ccc2C(=O)c3ccccc3C(=O)c2c1
Molecular structure of 2-hydroxyanthracene-9,10-dione
Melting point:306 °C
1g dissolves in:
909,090.91g water

Isomers

diphenic anhydride
Molecular structure of diphenic anhydride
9-fluorenone-1-carboxylic acid
Molecular structure of 9-fluorenone-1-carboxylic acid
9-fluorenone-2-carboxylic acid
Molecular structure of 9-fluorenone-2-carboxylic acid
1-hydroxyanthracene-9,10-dione
Molecular structure of 1-hydroxyanthracene-9,10-dione
2-hydroxyanthracene-9,10-dione
Molecular structure of 2-hydroxyanthracene-9,10-dione
9-oxofluorene-4-carboxylic acid
Molecular structure of 9-oxofluorene-4-carboxylic acid