2-nitrophenol


o-nitrophenol; 2-nitrophenol
Links:📏 NIST, ⚗️ ChemSynthesis
CAS:[88-75-5]
Formula:C6H5NO3; 139.11 g/mol
InChiKey:IQUPABOKLQSFBK-UHFFFAOYSA-N
SMILES:Oc1ccccc1[N+]([O-])=O
Molecular structure of 2-nitrophenol
Density:1.490 g/mL
Molar volume:93.4 mL/mol
Dielectric constant:17.30
Dipole moment:3.01 D
Melting point:45 °C
Boiling point:216 °C
Antoine equation
P(Torr) vs T(°C)
Vapour pressure vs temperature
Log10 partition octanol / water:1.77
Dimroth ET:44.4
1g dissolves in:
0.81g toluene;    1.05g benzene;    1.09g 1,2-dibromoethane;    480.77g water

Isomers

1,6-dihydro-6-oxo-3-pyridinecarboxylic acid
Molecular structure of 1,6-dihydro-6-oxo-3-pyridinecarboxylic acid
1-(2-furyl)-2-nitroethylene
Molecular structure of 1-(2-furyl)-2-nitroethylene
2-hydroxynicotinic acid
Molecular structure of 2-hydroxynicotinic acid
6-hydroxynicotinic acid
Molecular structure of 6-hydroxynicotinic acid
3-hydroxypicolinic acid
Molecular structure of 3-hydroxypicolinic acid
5-hydroxypicolinic acid
Molecular structure of 5-hydroxypicolinic acid
3-hydroxypyridine-2-carboxylic acid
Molecular structure of 3-hydroxypyridine-2-carboxylic acid
6-hydroxypyridine-2-carboxylic acid
Molecular structure of 6-hydroxypyridine-2-carboxylic acid
6-hydroxypyridine-3-carboxylic acid
Molecular structure of 6-hydroxypyridine-3-carboxylic acid
isonicotinic acid N-oxide
Molecular structure of isonicotinic acid N-oxide
nicotinic acid N-oxide
Molecular structure of nicotinic acid N-oxide
2-nitrophenol
Molecular structure of 2-nitrophenol
3-nitrophenol
Molecular structure of 3-nitrophenol
4-nitrophenol
Molecular structure of 4-nitrophenol
picolinic acid N-oxide
Molecular structure of picolinic acid N-oxide