3-bromobenzoic acid


m-bromobenzoic acid; 3-bromobenzoic acid
Links:⚗️ ChemSynthesis
CAS:[585-76-2]
Formula:C7H5BrO2; 201.02 g/mol
InChiKey:VOIZNVUXCQLQHS-UHFFFAOYSA-N
SMILES:OC(=O)c1cccc(Br)c1
Molecular structure of 3-bromobenzoic acid
Density:1.948 g/mL
Molar volume:103.2 mL/mol
Dipole moment:2.17 D
Melting point:155 °C
Log10 partition octanol / water:2.87
1g dissolves in:
2,487.56g water

Isomers

2-bromobenzoic acid
Molecular structure of 2-bromobenzoic acid
3-bromobenzoic acid
Molecular structure of 3-bromobenzoic acid
4-bromobenzoic acid
Molecular structure of 4-bromobenzoic acid
2-bromo-5-hydroxybenzaldehyde
Molecular structure of 2-bromo-5-hydroxybenzaldehyde
3-bromo-2-hydroxybenzaldehyde
Molecular structure of 3-bromo-2-hydroxybenzaldehyde
3-bromo-4-hydroxybenzaldehyde
Molecular structure of 3-bromo-4-hydroxybenzaldehyde
4-bromo-2-hydroxybenzaldehyde
Molecular structure of 4-bromo-2-hydroxybenzaldehyde
5-bromo-2-hydroxybenzaldehyde
Molecular structure of 5-bromo-2-hydroxybenzaldehyde
5-bromo-3-hydroxybenzaldehyde
Molecular structure of 5-bromo-3-hydroxybenzaldehyde
3-bromo-2-hydroxy-2,4,6-cycloheptatrien-1-one
Molecular structure of 3-bromo-2-hydroxy-2,4,6-cycloheptatrien-1-one
5-bromo-2-hydroxy-2,4,6-cycloheptatrien-1-one
Molecular structure of 5-bromo-2-hydroxy-2,4,6-cycloheptatrien-1-one
4-bromo-1,2-(methylenedioxy)benzene
Molecular structure of 4-bromo-1,2-(methylenedioxy)benzene