3-chlorobenzoic acid


m-chlorobenzoic acid; 3-chlorobenzoic acid
Links:⚗️ ChemSynthesis, 📖 PubMed
CAS:[535-80-8]
Formula:C7H5ClO2; 156.57 g/mol
InChiKey:LULAYUGMBFYYEX-UHFFFAOYSA-N
SMILES:OC(=O)c1cccc(Cl)c1
Molecular structure of 3-chlorobenzoic acid
Density:1.496 g/mL
Molar volume:104.7 mL/mol
Dipole moment:2.22 D
Melting point:158 °C
Log10 partition octanol / water:2.68
1g dissolves in:
5.04g diethyl ether;    204.08g carbon disulfide;    333.33g tetrachloromethane;    769.23g benzene;    769.23g hexane;    2,222.22g water

Isomers

5-chloro-1,3-benzodioxole
Molecular structure of 5-chloro-1,3-benzodioxole
2-chlorobenzoic acid
Molecular structure of 2-chlorobenzoic acid
3-chlorobenzoic acid
Molecular structure of 3-chlorobenzoic acid
4-chlorobenzoic acid
Molecular structure of 4-chlorobenzoic acid
2-chloro-3-hydroxybenzaldehyde
Molecular structure of 2-chloro-3-hydroxybenzaldehyde
2-chloro-4-hydroxybenzaldehyde
Molecular structure of 2-chloro-4-hydroxybenzaldehyde
2-chloro-6-hydroxybenzaldehyde
Molecular structure of 2-chloro-6-hydroxybenzaldehyde
3-chloro-2-hydroxybenzaldehyde
Molecular structure of 3-chloro-2-hydroxybenzaldehyde
3-chloro-4-hydroxybenzaldehyde
Molecular structure of 3-chloro-4-hydroxybenzaldehyde
4-chloro-2-hydroxybenzaldehyde
Molecular structure of 4-chloro-2-hydroxybenzaldehyde
5-chloro-2-hydroxybenzaldehyde
Molecular structure of 5-chloro-2-hydroxybenzaldehyde
2-hydroxybenzoyl chloride
Molecular structure of 2-hydroxybenzoyl chloride
phenyl chloroformate
Molecular structure of phenyl chloroformate