3-methylbenzenesulfonamide


m-methylbenzenesulfonamide; 3-methylbenzenesulfonamide; m-toluenesulfonamide
Formula:C7H9NO2S; 171.22 g/mol
InChiKey:NVZINPVISUVPHW-UHFFFAOYSA-N
SMILES:Cc1cccc(c1)[S](N)(=O)=O
Molecular structure of 3-methylbenzenesulfonamide
Log10 partition octanol / water:0.85
1g dissolves in:
128.01g water

Isomers

ethyl 2-methylthiazole-4-carboxylate
Molecular structure of ethyl 2-methylthiazole-4-carboxylate
ethyl 4-methyl-1,3-thiazole-5-carboxylate
Molecular structure of ethyl 4-methyl-1,3-thiazole-5-carboxylate
2-ethyl-4-methyl-1,3-thiazole-5-carboxylic acid
Molecular structure of 2-ethyl-4-methyl-1,3-thiazole-5-carboxylic acid
methyl 3-amino-4-methylthiophene-2-carboxylate
Molecular structure of methyl 3-amino-4-methylthiophene-2-carboxylate
2-methylbenzenesulfonamide
Molecular structure of 2-methylbenzenesulfonamide
3-methylbenzenesulfonamide
Molecular structure of 3-methylbenzenesulfonamide
4-methylbenzenesulfonamide
Molecular structure of 4-methylbenzenesulfonamide
4-(methylsulfonyl)aniline
Molecular structure of 4-(methylsulfonyl)aniline
N-phenylmethanesulfonamide
Molecular structure of N-phenylmethanesulfonamide
phenylmethanesulfonamide
Molecular structure of phenylmethanesulfonamide
3-(2-thienyl)-DL-alanine
Molecular structure of 3-(2-thienyl)-DL-alanine