3-nitrobenzaldehyde


m-nitrobenzaldehyde; 3-nitrobenzaldehyde
Links:📏 NIST, ⚗️ ChemSynthesis, 📖 PubMed
CAS:[99-61-6]
Formula:C7H5NO3; 151.12 g/mol
InChiKey:ZETIVVHRRQLWFW-UHFFFAOYSA-N
SMILES:[O-][N+](=O)c1cccc(C=O)c1
Molecular structure of 3-nitrobenzaldehyde
Dipole moment:3.39 D
Melting point:58 °C
Boiling point:278 °C
Antoine equation
P(Torr) vs T(°C)
Vapour pressure vs temperature
Log10 partition octanol / water:1.47
1g dissolves in:
615.38g water

Isomers

6-hydroxy-2-benzoxazolinone
Molecular structure of 6-hydroxy-2-benzoxazolinone
2-nitrobenzaldehyde
Molecular structure of 2-nitrobenzaldehyde
3-nitrobenzaldehyde
Molecular structure of 3-nitrobenzaldehyde
4-nitrobenzaldehyde
Molecular structure of 4-nitrobenzaldehyde