3-nitrophenol


m-nitrophenol; 3-nitrophenol
Links:📏 NIST, ⚗️ ChemSynthesis, 📖 PubMed
CAS:[554-84-7]
Formula:C6H5NO3; 139.11 g/mol
InChiKey:RTZZCYNQPHTPPL-UHFFFAOYSA-N
SMILES:Oc1cccc(c1)[N+]([O-])=O
Molecular structure of 3-nitrophenol
Density:1.490 g/mL
Molar volume:93.4 mL/mol
Dipole moment:4.47 D
Melting point:97 °C
Log10 partition octanol / water:2.62
1g dissolves in:
20.62g toluene;    45.66g water

Isomers

1,6-dihydro-6-oxo-3-pyridinecarboxylic acid
Molecular structure of 1,6-dihydro-6-oxo-3-pyridinecarboxylic acid
1-(2-furyl)-2-nitroethylene
Molecular structure of 1-(2-furyl)-2-nitroethylene
2-hydroxynicotinic acid
Molecular structure of 2-hydroxynicotinic acid
6-hydroxynicotinic acid
Molecular structure of 6-hydroxynicotinic acid
3-hydroxypicolinic acid
Molecular structure of 3-hydroxypicolinic acid
5-hydroxypicolinic acid
Molecular structure of 5-hydroxypicolinic acid
3-hydroxypyridine-2-carboxylic acid
Molecular structure of 3-hydroxypyridine-2-carboxylic acid
6-hydroxypyridine-2-carboxylic acid
Molecular structure of 6-hydroxypyridine-2-carboxylic acid
6-hydroxypyridine-3-carboxylic acid
Molecular structure of 6-hydroxypyridine-3-carboxylic acid
isonicotinic acid N-oxide
Molecular structure of isonicotinic acid N-oxide
nicotinic acid N-oxide
Molecular structure of nicotinic acid N-oxide
2-nitrophenol
Molecular structure of 2-nitrophenol
3-nitrophenol
Molecular structure of 3-nitrophenol
4-nitrophenol
Molecular structure of 4-nitrophenol
picolinic acid N-oxide
Molecular structure of picolinic acid N-oxide