3-nitrophthalic acid 2-butyl ester

Home   ::   Tables for Chemistry   ::   Compound classes

3-nitrophthalic acid 2-butyl ester
Formula:C12H13NO6; 267.24 g/mol
InChiKey:FMPUSJAPIITOEY-UHFFFAOYSA-N
SMILES:CCC(C)OC(=O)c1cccc(c1C(O)=O)[N+]([O-])=O
Molecular structure of 3-nitrophthalic acid 2-butyl ester

Isomers

N-benzyloxycarbonyl-L-aspartic acid
Molecular structure of N-benzyloxycarbonyl-L-aspartic acid
3-hydroxy-3-(phenylcarbamoyl)pentanedioic acid
Molecular structure of 3-hydroxy-3-(phenylcarbamoyl)pentanedioic acid
3-nitrophthalic acid 2-butyl ester
Molecular structure of 3-nitrophthalic acid 2-butyl ester
3-nitrophthalic acid 2-isobutyl ester
Molecular structure of 3-nitrophthalic acid 2-isobutyl ester
  ::     ::   Zla Mavka