4'-ethoxyacetanilide


p-acetphenetidin; N-acetyl-4-ethoxyaniline; acetyl-p-phenetidine; p-ethoxyacetanilide; 4-ethoxyacetanilide; 4'-ethoxyacetanilide; N-(4-ethoxyphenyl)acetamide; p-phenacetin; phenacetin
Links:📏 NIST, 📖 PubMed,
📖Houben-Weyl, 2. Band (Phenacetin); p. 276, 416
MeSH:Analgesics; Central Nervous System Agents; Sensory System Agents
CAS:[62-44-2]
Formula:C10H13NO2; 179.22 g/mol
InChiKey:CPJSUEIXXCENMM-UHFFFAOYSA-N
SMILES:O=C(Nc1ccc(OCC)cc1)C
Molecular structure of 4'-ethoxyacetanilide
Melting point:137 °C
Boiling point:244 °C
Log10 partition octanol / water:1.58
1g dissolves in:
6.33g acetic acid;    8.33g 2-propanone;    9.62g aniline;    10.85g benzaldehyde;    20.00g trichloromethane;    27.47g pentanol;    63.29g diethyl ether;    153.85g benzene;    333.33g toluene;    1,305.48g water

Isomers

2-amino-2-methyl-3-phenylpropanoic acid
Molecular structure of 2-amino-2-methyl-3-phenylpropanoic acid
2-amino-4-phenylbutanoic acid
Molecular structure of 2-amino-4-phenylbutanoic acid
4-amino-3-phenylbutanoic acid
Molecular structure of 4-amino-3-phenylbutanoic acid
4-(4-aminophenyl)butanoic acid
Molecular structure of 4-(4-aminophenyl)butanoic acid
2-amino-2-phenylbutyric acid
Molecular structure of 2-amino-2-phenylbutyric acid
6-amino-5,6,7,8-tetrahydronaphthalene-2,3-diol
Molecular structure of 6-amino-5,6,7,8-tetrahydronaphthalene-2,3-diol
benzyl ethylcarbamate
Molecular structure of benzyl ethylcarbamate
1-tert-butyl-3-nitrobenzene
Molecular structure of 1-tert-butyl-3-nitrobenzene
1-tert-butyl-4-nitrobenzene
Molecular structure of 1-tert-butyl-4-nitrobenzene
butyl pyridine-2-carboxylate
Molecular structure of butyl pyridine-2-carboxylate
butyl pyridine-3-carboxylate
Molecular structure of butyl pyridine-3-carboxylate
tert-butyl pyridine-3-carboxylate
Molecular structure of tert-butyl pyridine-3-carboxylate
butyl pyridine-4-carboxylate
Molecular structure of butyl pyridine-4-carboxylate
5-butylpyridine-2-carboxylic acid
Molecular structure of 5-butylpyridine-2-carboxylic acid
1-cyclohexylpyrrole-2,5-dione
Molecular structure of 1-cyclohexylpyrrole-2,5-dione
4-dimethylamino-2-methoxybenzaldehyde
Molecular structure of 4-dimethylamino-2-methoxybenzaldehyde
4-(dimethylamino)phenylacetic acid
Molecular structure of 4-(dimethylamino)phenylacetic acid
2',3'-dimethyl-4'-hydroxyacetanilide
Molecular structure of 2',3'-dimethyl-4'-hydroxyacetanilide
2',5'-dimethyl-4'-hydroxyacetanilide
Molecular structure of 2',5'-dimethyl-4'-hydroxyacetanilide
3',5'-dimethyl-4'-hydroxyacetanilide
Molecular structure of 3',5'-dimethyl-4'-hydroxyacetanilide
2,3-dimethylphenyl N-methylcarbamate
Molecular structure of 2,3-dimethylphenyl N-methylcarbamate
2,5-dimethylphenyl N-methylcarbamate
Molecular structure of 2,5-dimethylphenyl N-methylcarbamate
3,4-dimethylphenyl N-methylcarbamate
Molecular structure of 3,4-dimethylphenyl N-methylcarbamate
3,5-dimethylphenyl N-methylcarbamate
Molecular structure of 3,5-dimethylphenyl N-methylcarbamate
3-ethoxyacetanilide
Molecular structure of 3-ethoxyacetanilide
4'-ethoxyacetanilide
Molecular structure of 4'-ethoxyacetanilide
N-(2-ethoxyphenyl)acetamide
Molecular structure of N-(2-ethoxyphenyl)acetamide
ethyl 4-aminophenylacetate
Molecular structure of ethyl 4-aminophenylacetate
ethyl 2,4-dimethylnicotinate
Molecular structure of ethyl 2,4-dimethylnicotinate
3'-ethyl-4'-hydroxyacetanilide
Molecular structure of 3'-ethyl-4'-hydroxyacetanilide
ethyl 4-methylaminobenzoate
Molecular structure of ethyl 4-methylaminobenzoate
ethyl 2-(phenylamino)acetate
Molecular structure of ethyl 2-(phenylamino)acetate
2-ethylphenyl N-methylcarbamate
Molecular structure of 2-ethylphenyl N-methylcarbamate
3-ethylphenyl N-methylcarbamate
Molecular structure of 3-ethylphenyl N-methylcarbamate
4-ethylphenyl N-methylcarbamate
Molecular structure of 4-ethylphenyl N-methylcarbamate
homarylamine
Molecular structure of homarylamine
o-(2-hydroxyethyl)aminoacetophenone
Molecular structure of o-(2-hydroxyethyl)aminoacetophenone
N-(4-hydroxyphenyl)butanamide
Molecular structure of N-(4-hydroxyphenyl)butanamide
2-hydroxy-N-propylbenzamide
Molecular structure of 2-hydroxy-N-propylbenzamide
4-isopropyl-1-methyl-2-nitrobenzene
Molecular structure of 4-isopropyl-1-methyl-2-nitrobenzene
1-isopropyl-2-nitro-4-methylbenzene
Molecular structure of 1-isopropyl-2-nitro-4-methylbenzene
isopropyl N-phenylcarbamate
Molecular structure of isopropyl N-phenylcarbamate
2-methoxy-N,N-dimethylbenzamide
Molecular structure of 2-methoxy-N,N-dimethylbenzamide
3-methoxy-N,N-dimethylbenzamide
Molecular structure of 3-methoxy-N,N-dimethylbenzamide
4-methoxy-N,N-dimethylbenzamide
Molecular structure of 4-methoxy-N,N-dimethylbenzamide
N-(2-methoxy-3-methylphenyl)acetamide
Molecular structure of N-(2-methoxy-3-methylphenyl)acetamide
N-(2-methoxy-5-methylphenyl)acetamide
Molecular structure of N-(2-methoxy-5-methylphenyl)acetamide
N-(3-methoxy-2-methylphenyl)acetamide
Molecular structure of N-(3-methoxy-2-methylphenyl)acetamide
7-methoxy-1,2,3,4-tetrahydroisoquinolin-6-ol
Molecular structure of 7-methoxy-1,2,3,4-tetrahydroisoquinolin-6-ol
methyl 2-dimethylaminobenzoate
Molecular structure of methyl 2-dimethylaminobenzoate
methyl 4-dimethylaminobenzoate
Molecular structure of methyl 4-dimethylaminobenzoate
3,4-methylenedioxyamphetamine
Molecular structure of 3,4-methylenedioxyamphetamine
N-methyl-N-(2-hydroxyethyl)-4-aminobenzaldehyde
Molecular structure of N-methyl-N-(2-hydroxyethyl)-4-aminobenzaldehyde
(2-methylphenyl) N,N-dimethylcarbamate
Molecular structure of (2-methylphenyl) N,N-dimethylcarbamate
(3-methylphenyl) N,N-dimethylcarbamate
Molecular structure of (3-methylphenyl) N,N-dimethylcarbamate
(4-methylphenyl) N,N-dimethylcarbamate
Molecular structure of (4-methylphenyl) N,N-dimethylcarbamate
1-methylpropyl pyridine-3-carboxylate
Molecular structure of 1-methylpropyl pyridine-3-carboxylate
3-(4-morpholinyl)phenol
Molecular structure of 3-(4-morpholinyl)phenol
3-phenylpropyl carbamate
Molecular structure of 3-phenylpropyl carbamate
5-piperidin-1-ylfuran-2-carbaldehyde
Molecular structure of 5-piperidin-1-ylfuran-2-carbaldehyde
propan-2-yl 4-aminobenzoate
Molecular structure of propan-2-yl 4-aminobenzoate
propyl 4-aminobenzoate
Molecular structure of propyl 4-aminobenzoate
1,2,3,4-tetramethyl-5-nitrobenzene
Molecular structure of 1,2,3,4-tetramethyl-5-nitrobenzene