4-benzoylaniline


4-aminobenzophenone; 4-benzoylaniline
Links:📏 NIST, 📖 PubMed
CAS:[1137-41-3]
Formula:C13H11NO; 197.24 g/mol
InChiKey:RBKHNGHPZZZJCI-UHFFFAOYSA-N
SMILES:Nc1ccc(cc1)C(=O)c2ccccc2
Molecular structure of 4-benzoylaniline
Melting point:123 °C
Log10 partition octanol / water:2.46

Isomers

Molecular structure of 3-(1-naphthalenyloxy)propanenitrile
2-aminobenzophenone
Molecular structure of 2-aminobenzophenone
3-aminobenzophenone
Molecular structure of 3-aminobenzophenone
benzophenone oxime
Molecular structure of benzophenone oxime
4-benzoylaniline
Molecular structure of 4-benzoylaniline
benzylidene-4-hydroxyaniline
Molecular structure of benzylidene-4-hydroxyaniline
benzyl 4-pyridyl ketone
Molecular structure of benzyl 4-pyridyl ketone
biphenyl-2-carboxamide
Molecular structure of biphenyl-2-carboxamide
biphenyl-4-carboxamide
Molecular structure of biphenyl-4-carboxamide
C,N-diphenylnitrone
Molecular structure of C,N-diphenylnitrone
11,11α-dihydro-6H-pyrido[1,2-β]isoquinolin-6-one
Molecular structure of 11,11a-dihydro-6H-pyrido[1,2-b]isoquinolin-6-one
N,N-diphenylformamide
Molecular structure of N,N-diphenylformamide
N-(9H-fluoren-2-yl)hydroxylamine
Molecular structure of N-(9H-fluoren-2-yl)hydroxylamine
2-hydroxy-7-aminofluorene
Molecular structure of 2-hydroxy-7-aminofluorene
(E)-2-hydroxybenzalaniline
Molecular structure of (E)-2-hydroxybenzalaniline
5-methoxy-1H-benzo[γ]indole
Molecular structure of 5-methoxy-1H-benzo[g]indole
4-(4-methylbenzoyl)pyridine
Molecular structure of 4-(4-methylbenzoyl)pyridine
N-naphthalen-1-ylprop-2-enamide
Molecular structure of N-naphthalen-1-ylprop-2-enamide
(R)-(-)-1-(1-naphthyl)ethyl isocyanate
Molecular structure of (R)-(-)-1-(1-naphthyl)ethyl isocyanate
(S)-(+)-1-(1-naphthyl)ethyl isocyanate
Molecular structure of (S)-(+)-1-(1-naphthyl)ethyl isocyanate
N-phenylbenzamide
Molecular structure of N-phenylbenzamide
(E)-1-phenyl-3-(1H-pyrrol-2-yl)prop-2-en-1-one
Molecular structure of (E)-1-phenyl-3-(1H-pyrrol-2-yl)prop-2-en-1-one
(E)-3-phenyl-1-(1H-pyrrol-2-yl)prop-2-en-1-one
Molecular structure of (E)-3-phenyl-1-(1H-pyrrol-2-yl)prop-2-en-1-one
salicylideneaniline
Molecular structure of salicylideneaniline
4-styrylpyridine 1-oxide
Molecular structure of 4-styrylpyridine 1-oxide