4-bromobenzoic acid


p-bromobenzoic acid; 4-bromobenzoic acid
Links:⚗️ ChemSynthesis, 📖 PubMed
CAS:[586-76-5]
Formula:C7H5BrO2; 201.02 g/mol
InChiKey:TUXYZHVUPGXXQG-UHFFFAOYSA-N
SMILES:OC(=O)c1ccc(Br)cc1
Molecular structure of 4-bromobenzoic acid
Density:1.894 g/mL
Molar volume:106.1 mL/mol
Dipole moment:2.10 D
Melting point:252 °C
Log10 partition octanol / water:3.47
1g dissolves in:
17,857.14g water

Isomers

2-bromobenzoic acid
Molecular structure of 2-bromobenzoic acid
3-bromobenzoic acid
Molecular structure of 3-bromobenzoic acid
4-bromobenzoic acid
Molecular structure of 4-bromobenzoic acid
2-bromo-5-hydroxybenzaldehyde
Molecular structure of 2-bromo-5-hydroxybenzaldehyde
3-bromo-2-hydroxybenzaldehyde
Molecular structure of 3-bromo-2-hydroxybenzaldehyde
3-bromo-4-hydroxybenzaldehyde
Molecular structure of 3-bromo-4-hydroxybenzaldehyde
4-bromo-2-hydroxybenzaldehyde
Molecular structure of 4-bromo-2-hydroxybenzaldehyde
5-bromo-2-hydroxybenzaldehyde
Molecular structure of 5-bromo-2-hydroxybenzaldehyde
5-bromo-3-hydroxybenzaldehyde
Molecular structure of 5-bromo-3-hydroxybenzaldehyde
3-bromo-2-hydroxy-2,4,6-cycloheptatrien-1-one
Molecular structure of 3-bromo-2-hydroxy-2,4,6-cycloheptatrien-1-one
5-bromo-2-hydroxy-2,4,6-cycloheptatrien-1-one
Molecular structure of 5-bromo-2-hydroxy-2,4,6-cycloheptatrien-1-one
4-bromo-1,2-(methylenedioxy)benzene
Molecular structure of 4-bromo-1,2-(methylenedioxy)benzene