4-hydroxyazobenzene


C.I. solvent yellow 7; p-hydroxyazobenzene; 4-hydroxyazobenzene; 4-(phenylazo)phenol; 4-phenyldiazenylphenol
CAS:[1689-82-3]
Formula:C12H10N2O; 198.22 g/mol
InChiKey:BEYOBVMPDRKTNR-UHFFFAOYSA-N
SMILES:Oc1ccc(cc1)N=Nc2ccccc2
Molecular structure of 4-hydroxyazobenzene
Dipole moment:2.07 D
Melting point:150 °C
Log10 partition octanol / water:3.18
1g dissolves in:
449.44g water

Isomers

azoxybenzene
Molecular structure of azoxybenzene
harmol
Molecular structure of harmol
2-hydroxyazobenzene
Molecular structure of 2-hydroxyazobenzene
3-hydroxyazobenzene
Molecular structure of 3-hydroxyazobenzene
4-hydroxyazobenzene
Molecular structure of 4-hydroxyazobenzene
(E)-1-imidazol-1-yl-3-phenylprop-2-en-1-one
Molecular structure of (E)-1-imidazol-1-yl-3-phenylprop-2-en-1-one
N-nitrosodiphenylamine
Molecular structure of N-nitrosodiphenylamine
4-nitroso-N-phenylbenzenamine
Molecular structure of 4-nitroso-N-phenylbenzenamine
1,10-phenanthroline monohydrate
Molecular structure of 1,10-phenanthroline monohydrate
4-(phenylhydrazinylidene)cyclohexa-2,5-dien-1-one
Molecular structure of 4-(phenylhydrazinylidene)cyclohexa-2,5-dien-1-one
N-phenylpyridine-3-carboxamide
Molecular structure of N-phenylpyridine-3-carboxamide
9H-pyrido[5,4-β]indol-3-ylmethanol
Molecular structure of 9H-pyrido[5,4-b]indol-3-ylmethanol