4-hydroxybenzenesulfonic acid


4-hydroxybenzenesulfonic acid; 4-hydroxyphenylsulfonic acid; 4-phenolsulfonic acid; phenolsulfuric acid; sulfocarbolic acid
Links:📏 NIST, 📖 PubMed
CAS RN:[98-67-9]
Formula:C6H6O4S; 174.18 g/mol
InChiKey:FEPBITJSIHRMRT-UHFFFAOYSA-N
SMILES:Oc1ccc(cc1)[S](O)(=O)=O
Molecular structure of 4-hydroxybenzenesulfonic acid
Use:organic syntheses of dyes, intermediates, drugs, and disinfectants; water analysis
Density:1.155 g/mL
Molar volume:150.8 mL/mol
Refractive index:1.489
Molecular refractive power:43.52 mL/mol

Isomers

3-hydroxybenzenesulfonic acid
Molecular structure of 3-hydroxybenzenesulfonic acid
4-hydroxybenzenesulfonic acid
Molecular structure of 4-hydroxybenzenesulfonic acid
S-acetylmercaptosuccinic anhydride
Molecular structure of S-acetylmercaptosuccinic anhydride