4-nitrophenol


acetaminophen related compound F; p-nitrophenol; 4-nitrophenol; paracetamol impurity F
Links:📏 NIST, ⚗️ ChemSynthesis, 📖 PubMed
CAS:[100-02-7]
Formula:C6H5NO3; 139.11 g/mol
InChiKey:BTJIUGUIPKRLHP-UHFFFAOYSA-N
SMILES:Oc1ccc(cc1)[N+]([O-])=O
Molecular structure of 4-nitrophenol
Density:1.480 g/mL
Molar volume:94.0 mL/mol
Dipole moment:5.43 D
Melting point:114 °C
Boiling point:279 °C
Vapour pressure:1 Torr
Log10 partition octanol / water:1.91
1g dissolves in:
74.63g water

Isomers

1,6-dihydro-6-oxo-3-pyridinecarboxylic acid
Molecular structure of 1,6-dihydro-6-oxo-3-pyridinecarboxylic acid
1-(2-furyl)-2-nitroethylene
Molecular structure of 1-(2-furyl)-2-nitroethylene
2-hydroxynicotinic acid
Molecular structure of 2-hydroxynicotinic acid
6-hydroxynicotinic acid
Molecular structure of 6-hydroxynicotinic acid
3-hydroxypicolinic acid
Molecular structure of 3-hydroxypicolinic acid
5-hydroxypicolinic acid
Molecular structure of 5-hydroxypicolinic acid
3-hydroxypyridine-2-carboxylic acid
Molecular structure of 3-hydroxypyridine-2-carboxylic acid
6-hydroxypyridine-2-carboxylic acid
Molecular structure of 6-hydroxypyridine-2-carboxylic acid
6-hydroxypyridine-3-carboxylic acid
Molecular structure of 6-hydroxypyridine-3-carboxylic acid
isonicotinic acid N-oxide
Molecular structure of isonicotinic acid N-oxide
nicotinic acid N-oxide
Molecular structure of nicotinic acid N-oxide
2-nitrophenol
Molecular structure of 2-nitrophenol
3-nitrophenol
Molecular structure of 3-nitrophenol
4-nitrophenol
Molecular structure of 4-nitrophenol
picolinic acid N-oxide
Molecular structure of picolinic acid N-oxide