5,5-diethylbarbituric acid


barbital; 5,5-diethylbarbiturate; diethylbarbituric acid; 5,5-diethylbarbituric acid; 5,5-diethyl-1,3-diazinane-2,4,6-trione; 5,5-diethyl-2,4,6(1H,3H,5H)-pyrimidinetrione; veronal
Links:🌍 Wikipedia, 📏 NIST, 📖 PubMed,
📖Houben-Weyl, 2. Band (Veronal); p. 235, 491, 577
MeSH:Central Nervous System Agents; GABA Modulators; Neurotransmitter Agents
CAS:[57-44-3]
Formula:C8H12N2O3; 184.19 g/mol
InChiKey:FTOAOBMCPZCFFF-UHFFFAOYSA-N
SMILES:CCC1(CC)C(=O)NC(=O)NC1=O
Molecular structure of 5,5-diethylbarbituric acid
Melting point:190 °C
Log10 partition octanol / water:0.65
1g dissolves in:
11.49g ethanol;    160.00g water

Isomers

5,5-diethylbarbituric acid
Molecular structure of 5,5-diethylbarbituric acid
ethyl 1-(hydroxymethyl)-5-methyl-1H-pyrazole-3-carboxylate
Molecular structure of ethyl 1-(hydroxymethyl)-5-methyl-1H-pyrazole-3-carboxylate
methyl 3-(4-imidazolyl)-2-methoxypropanoate
Molecular structure of methyl 3-(4-imidazolyl)-2-methoxypropanoate
primocarcin
Molecular structure of primocarcin