7,9-dihydro-3H-purine-2,6,8-trione


7,9-dihydro-3H-purine-2,6,8-trione; 2,6,8-trihydroxypurine; uric acid
Links:🌍 Wikipedia, 📖 PubMed,
📖Houben-Weyl, 2. Band (Harnsäure); p. 235, 423, 886,
📖Org. Chem., v. Richter, 1. Vol (Uric Acid); p. 336, 416, 455, 545, 572, 581, 583, 587, 591, 575578
MeSH:Antioxidants; Protective Agents
CAS:[69-93-2]
Formula:C5H4N4O3; 168.11 g/mol
InChiKey:LEHOTFFKMJEONL-UHFFFAOYSA-N
SMILES:O=C1NC(=O)C2=C(N1)NC(=O)N2
Molecular structure of 7,9-dihydro-3H-purine-2,6,8-trione
Density:1.890 g/mL
Molar volume:88.9 mL/mol
Melting point:300 °C
Log10 partition octanol / water:-2.17
1g dissolves in:
16,666.67g water