D-mannitol


(2R,3R,4R,5R)-hexane-1,2,3,4,5,6-hexol; (2R,3R,4R,5R)-hexan-1,2,3,4,5,6-hexol; D(-)-mannitol; D-mannitol; mannitol
Links:🌍 Wikipedia, 📏 NIST, 📖 PubMed,
📖Houben-Weyl, 2. Band (Mannit); p. 25, 46, 202, 425, 503, 909, 984,
📖Org. Chem., v. Richter, 1. Vol (Mannitol); p. 99, 112, 601, 623, 627, 631, 632, 633, 683
MeSH:Diuretics, Osmotic; Food Additives; Natriuretic Agents
CAS:[69-65-8]
Formula:C6H14O6; 182.17 g/mol
InChiKey:FBPFZTCFMRRESA-KVTDHHQDSA-N
SMILES:OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO
Molecular structure of D-mannitol
Density:1.489 g/mL
Molar volume:122.3 mL/mol
Dielectric constant:24.60
Melting point:190 °C
Log10 partition octanol / water:-3.10
1g dissolves in:
5.65g water;    64.10g ethanol

Isomers

galactitol
Molecular structure of galactitol
D-mannitol
Molecular structure of D-mannitol
sorbitol
Molecular structure of sorbitol
talitol
Molecular structure of talitol