N-(2,4-dichlorophenyl)acetamide


2,4-dichloroacetanilide; 2',4'-dichloroacetanilide; N-(2,4-dichlorophenyl)acetamide
Links:📏 NIST, ⚗️ ChemSynthesis
CAS:[6975-29-7]
Formula:C8H7Cl2NO; 204.06 g/mol
InChiKey:GZSGTFDLLISMMA-UHFFFAOYSA-N
SMILES:CC(=O)Nc1ccc(Cl)cc1Cl
Molecular structure of N-(2,4-dichlorophenyl)acetamide
Melting point:147 °C
1g dissolves in:
15.70g acetic acid;    23.85g ethanol

Isomers

4'-amino-3',5'-dichloroacetophenone
Molecular structure of 4'-amino-3',5'-dichloroacetophenone
2,2-dichloro-N-phenylacetamide
Molecular structure of 2,2-dichloro-N-phenylacetamide
N-(2,3-dichlorophenyl)acetamide
Molecular structure of N-(2,3-dichlorophenyl)acetamide
N-(2,4-dichlorophenyl)acetamide
Molecular structure of N-(2,4-dichlorophenyl)acetamide
2,6-dichlorophenylacetamide
Molecular structure of 2,6-dichlorophenylacetamide
N-(2,6-dichlorophenyl)acetamide
Molecular structure of N-(2,6-dichlorophenyl)acetamide