N-(4-nitrophenyl)acetamide


p-nitroacetanilide; 4-nitroacetanilide; 4'-nitroacetanilide; N-(4-nitrophenyl)acetamide
Links:🌍 Wikipedia, 📏 NIST, 🕷 ChemSpider, 📖 PubMed
CAS:[104-04-1]
Formula:C8H8N2O3; 180.16 g/mol
InChiKey:NQRLPDFELNCFHW-UHFFFAOYSA-N
SMILES:CC(=O)Nc1ccc(cc1)[N+]([O-])=O
Molecular structure of N-(4-nitrophenyl)acetamide
Melting point:216 °C
Log10 partition octanol / water:1.66
1g dissolves in:
120.48g acetic acid

Isomers

1,3-benzodioxole-5-carbohydrazide
Molecular structure of 1,3-benzodioxole-5-carbohydrazide
5,5-di(ethenyl)-1,3-diazinane-2,4,6-trione
Molecular structure of 5,5-di(ethenyl)-1,3-diazinane-2,4,6-trione
3-methyl-4-nitrobenzamide
Molecular structure of 3-methyl-4-nitrobenzamide
4-methyl-3-nitrobenzamide
Molecular structure of 4-methyl-3-nitrobenzamide
4'-nitroacetophenone oxime
Molecular structure of 4'-nitroacetophenone oxime
N-(2-nitrophenyl)acetamide
Molecular structure of N-(2-nitrophenyl)acetamide
N-(3-nitrophenyl)acetamide
Molecular structure of N-(3-nitrophenyl)acetamide
N-(4-nitrophenyl)acetamide
Molecular structure of N-(4-nitrophenyl)acetamide
phenyl N-carbamoylcarbamate
Molecular structure of phenyl N-carbamoylcarbamate