N-benzoylglycine


2-benzamidoacetic acid; N-benzoylglycine; hippuric acid
Links:📏 NIST, 📖 PubMed,
📖Org. Chem., v. Richter, 1. Vol (Hippuric Acid); p. 385, 386, 388, 581, 666
CAS:[495-69-2]
Formula:C9H9NO3; 179.18 g/mol
InChiKey:QIAFMBKCNZACKA-UHFFFAOYSA-N
SMILES:OC(=O)CNC(=O)c1ccccc1
Molecular structure of N-benzoylglycine
Density:1.371 g/mL
Molar volume:130.7 mL/mol
Melting point:187 °C
Boiling point:240 °C
Log10 partition octanol / water:0.31
1g dissolves in:
10.20g methanol;    19.23g ethanol;    35.71g propanol;    238.10g water

Isomers

2-acetamidobenzoic acid
Molecular structure of 2-acetamidobenzoic acid
3-acetamidobenzoic acid
Molecular structure of 3-acetamidobenzoic acid
4-acetamidobenzoic acid
Molecular structure of 4-acetamidobenzoic acid
5-acetylsalicylamide
Molecular structure of 5-acetylsalicylamide
N-benzoylglycine
Molecular structure of N-benzoylglycine
2-(benzoyloxy)acetamide
Molecular structure of 2-(benzoyloxy)acetamide
2-carbamoylphenyl acetate
Molecular structure of 2-carbamoylphenyl acetate
3-carbamoylphenyl acetate
Molecular structure of 3-carbamoylphenyl acetate
4-carbamoylphenyl acetate
Molecular structure of 4-carbamoylphenyl acetate
2,4-dimethoxyphenyl isocyanate
Molecular structure of 2,4-dimethoxyphenyl isocyanate
2,5-dimethoxyphenyl isocyanate
Molecular structure of 2,5-dimethoxyphenyl isocyanate
erbstatin
Molecular structure of erbstatin
4-ethyl-3-nitrobenzaldehyde
Molecular structure of 4-ethyl-3-nitrobenzaldehyde
N-hydroxy-5-norbornene-2,3-dicarboxylic acid imide
Molecular structure of N-hydroxy-5-norbornene-2,3-dicarboxylic acid imide
1-methoxy-3-[(E)-2-nitroethenyl]benzene
Molecular structure of 1-methoxy-3-[(E)-2-nitroethenyl]benzene
1-methoxy-4-[(E)-2-nitroethenyl]benzene
Molecular structure of 1-methoxy-4-[(E)-2-nitroethenyl]benzene
trans-2-methoxy-β-nitrostyrene
Molecular structure of trans-2-methoxy-b-nitrostyrene
methyl 2-carbamoylbenzoate
Molecular structure of methyl 2-carbamoylbenzoate
methyl 3-carbamoylbenzoate
Molecular structure of methyl 3-carbamoylbenzoate
methyl 4-carbamoylbenzoate
Molecular structure of methyl 4-carbamoylbenzoate
2'-methyl-5'-nitroacetophenone
Molecular structure of 2'-methyl-5'-nitroacetophenone
4'-methyl-3'-nitroacetophenone
Molecular structure of 4'-methyl-3'-nitroacetophenone
1-(3-nitrophenyl)propan-1-one
Molecular structure of 1-(3-nitrophenyl)propan-1-one
(E)-3-(4-nitrophenyl)prop-2-en-1-ol
Molecular structure of (E)-3-(4-nitrophenyl)prop-2-en-1-ol
(phenylmethyleneaminooxy)acetic acid
Molecular structure of (phenylmethyleneaminooxy)acetic acid
salacetamide
Molecular structure of salacetamide